C29H28BClFN5O4S — CID 160865316
N-[4-(3-chloropyrazin-2-yl)oxyphenyl]-7-fluoro-1,3-benzothiazol-2-amine;2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 160865316) has the molecular formula C29H28BClFN5O4S and a molecular weight of 607.90 g/mol. Its IUPAC name is N-[4-(3-chloropyrazin-2-yl)oxyphenyl]-7-fluoro-1,3-benzothiazol-2-amine;2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | N-[4-(3-chloropyrazin-2-yl)oxyphenyl]-7-fluoro-1,3-benzothiazol-2-amine;2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 160865316 |
| Molecular Formula | C29H28BClFN5O4S |
| Molecular Weight | 607.90 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | N-[4-(3-chloropyrazin-2-yl)oxyphenyl]-7-fluoro-1,3-benzothiazol-2-amine;2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | COc1ncccc1B1OC(C)(C)C(C)(C)O1.Fc1cccc2nc(Nc3ccc(Oc4nccnc4Cl)cc3)sc12 |
| InChI | InChI=1S/C17H10ClFN4OS.C12H18BNO3/c18-15-16(21-9-8-20-15)24-11-6-4-10(5-7-11)22-17-23-13-3-1-2-12(19)14(13)25-17;1-11(2)12(3,4)17-13(16-11)9-7-6-8-14-10(9)15-5/h1-9H,(H,22,23);6-8H,1-5H3 |
| InChIKey | SLAOAIQBVHCFIJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.90 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|