C34H36O4 — CID 160865394
[2-methoxy-3-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methanol (PubChem CID 160865394) has the molecular formula C34H36O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is [2-methoxy-3-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methanol.
| Compound Name | [2-methoxy-3-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 160865394 |
| Molecular Formula | C34H36O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | [2-methoxy-3-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methanol |
| SMILES | COc1c(/C=C/c2ccc(C)cc2)cccc1CO.COc1c(/C=C/c2ccc(C)cc2)cccc1CO |
| InChI | InChI=1S/2C17H18O2/c2*1-13-6-8-14(9-7-13)10-11-15-4-3-5-16(12-18)17(15)19-2/h2*3-11,18H,12H2,1-2H3/b2*11-10+ |
| InChIKey | SLAWMVLPAYOHFW-YFGZYSTASA-N |
| XLogP | 7.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|