C30H36BF8N3O4 — CID 160872987
1-[(4-cyano-2-fluorophenyl)-(2-ethoxy-6-oxocyclohexen-1-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea;triethyloxidanium;tetrafluoroborate (PubChem CID 160872987) has the molecular formula C30H36BF8N3O4 and a molecular weight of 665.43 g/mol. Its IUPAC name is 1-[(4-cyano-2-fluorophenyl)-(2-ethoxy-6-oxocyclohexen-1-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea;triethyloxidanium;tetrafluoroborate.
| Compound Name | 1-[(4-cyano-2-fluorophenyl)-(2-ethoxy-6-oxocyclohexen-1-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea;triethyloxidanium;tetrafluoroborate |
|---|---|
| PubChem CID | 160872987 |
| Molecular Formula | C30H36BF8N3O4 |
| Molecular Weight | 665.43 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | 1-[(4-cyano-2-fluorophenyl)-(2-ethoxy-6-oxocyclohexen-1-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea;triethyloxidanium;tetrafluoroborate |
| SMILES | CCOC1=C(C(NC(=O)Nc2cccc(C(F)(F)F)c2)c2ccc(C#N)cc2F)C(=O)CCC1.CC[O+](CC)CC.F[B-](F)(F)F |
| InChI | InChI=1S/C24H21F4N3O3.C6H15O.BF4/c1-2-34-20-8-4-7-19(32)21(20)22(17-10-9-14(13-29)11-18(17)25)31-23(33)30-16-6-3-5-15(12-16)24(26,27)28;1-4-7(5-2)6-3;2-1(3,4)5/h3,5-6,9-12,22H,2,4,7-8H2,1H3,(H2,30,31,33);4-6H2,1-3H3;/q;+1;-1 |
| InChIKey | SLZTTZFBNGWOKX-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.43 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|