About methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate
methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate (PubChem CID 160876290) has the molecular formula C20H22F2N2O4S
and a molecular weight of 424.47 g/mol. Its IUPAC name is methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate |
| PubChem CID | 160876290 |
| Molecular Formula | C20H22F2N2O4S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(F)cc(CN)c1.COC(=O)c1cc(F)cc(CNC(C)=S)c1 |
| InChI | InChI=1S/C11H12FNO2S.C9H10FNO2/c1-7(16)13-6-8-3-9(11(14)15-2)5-10(12)4-8;1-13-9(12)7-2-6(5-11)3-8(10)4-7/h3-5H,6H2,1-2H3,(H,13,16);2-4H,5,11H2,1H3 |
| InChIKey | SMKZGRKMFGECJQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate?
The IUPAC name of methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate (CID 160876290) is methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate.
What is the SMILES notation for methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate?
The canonical SMILES for methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate is COC(=O)c1cc(F)cc(CN)c1.COC(=O)c1cc(F)cc(CNC(C)=S)c1.
What is the InChIKey of methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate?
The InChIKey is SMKZGRKMFGECJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO2S.C9H10FNO2/c1-7(16)13-6-8-3-9(11(14)15-2)5-10(12)4-8;1-13-9(12)7-2-6(5-11)3-8(10)4-7/h3-5H,6H2,1-2H3,(H,13,16);2-4H,5,11H2,1H3.
What are the key properties of methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate?
methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate has a molecular weight of 424.47 g/mol, XLogP of 3.12, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(aminomethyl)-5-fluorobenzoate;methyl 3-[(ethanethioylamino)methyl]-5-fluorobenzoate is sourced from PubChem (CID 160876290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).