C21H18ClFN6OS — CID 160876937
2-chloro-N-[5-(1-cyano-4-methyl-3,6-dihydro-2H-pyridin-5-yl)pyrazin-2-yl]-6-fluorobenzamide;1,3-thiazole (PubChem CID 160876937) has the molecular formula C21H18ClFN6OS and a molecular weight of 456.93 g/mol. Its IUPAC name is 2-chloro-N-[5-(1-cyano-4-methyl-3,6-dihydro-2H-pyridin-5-yl)pyrazin-2-yl]-6-fluorobenzamide;1,3-thiazole.
| Compound Name | 2-chloro-N-[5-(1-cyano-4-methyl-3,6-dihydro-2H-pyridin-5-yl)pyrazin-2-yl]-6-fluorobenzamide;1,3-thiazole |
|---|---|
| PubChem CID | 160876937 |
| Molecular Formula | C21H18ClFN6OS |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-chloro-N-[5-(1-cyano-4-methyl-3,6-dihydro-2H-pyridin-5-yl)pyrazin-2-yl]-6-fluorobenzamide;1,3-thiazole |
| SMILES | CC1=C(c2cnc(NC(=O)c3c(F)cccc3Cl)cn2)CN(C#N)CC1.c1cscn1 |
| InChI | InChI=1S/C18H15ClFN5O.C3H3NS/c1-11-5-6-25(10-21)9-12(11)15-7-23-16(8-22-15)24-18(26)17-13(19)3-2-4-14(17)20;1-2-5-3-4-1/h2-4,7-8H,5-6,9H2,1H3,(H,23,24,26);1-3H |
| InChIKey | SMNCFCBDXDDIAD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|