C21H21F2N3O — CID 143518331
N-[4-(1-cyano-4-methyl-3,6-dihydro-2H-pyridin-5-yl)-6-methylcyclohexa-1,3-dien-1-yl]-2,6-difluorobenzamide (PubChem CID 143518331) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[4-(1-cyano-4-methyl-3,6-dihydro-2H-pyridin-5-yl)-6-methylcyclohexa-1,3-dien-1-yl]-2,6-difluorobenzamide.
| Compound Name | N-[4-(1-cyano-4-methyl-3,6-dihydro-2H-pyridin-5-yl)-6-methylcyclohexa-1,3-dien-1-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 143518331 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[4-(1-cyano-4-methyl-3,6-dihydro-2H-pyridin-5-yl)-6-methylcyclohexa-1,3-dien-1-yl]-2,6-difluorobenzamide |
| SMILES | CC1=C(C2=CC=C(NC(=O)c3c(F)cccc3F)C(C)C2)CN(C#N)CC1 |
| InChI | InChI=1S/C21H21F2N3O/c1-13-8-9-26(12-24)11-16(13)15-6-7-19(14(2)10-15)25-21(27)20-17(22)4-3-5-18(20)23/h3-7,14H,8-11H2,1-2H3,(H,25,27) |
| InChIKey | SZJXGVPJJAKBFF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|