About N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide
N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide (PubChem CID 89250978) has the molecular formula C20H15F2N3O2
and a molecular weight of 367.36 g/mol. Its IUPAC name is N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide |
| PubChem CID | 89250978 |
| Molecular Formula | C20H15F2N3O2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide |
| SMILES | N#CN1CCC(C=O)=C(c2ccc(NC(=O)c3c(F)cccc3F)cc2)C1 |
| InChI | InChI=1S/C20H15F2N3O2/c21-17-2-1-3-18(22)19(17)20(27)24-15-6-4-13(5-7-15)16-10-25(12-23)9-8-14(16)11-26/h1-7,11H,8-10H2,(H,24,27) |
| InChIKey | IOWHMVNJFSQZBJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide?
The IUPAC name of N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide (CID 89250978) is N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide is N#CN1CCC(C=O)=C(c2ccc(NC(=O)c3c(F)cccc3F)cc2)C1.
What is the InChIKey of N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide?
The InChIKey is IOWHMVNJFSQZBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N3O2/c21-17-2-1-3-18(22)19(17)20(27)24-15-6-4-13(5-7-15)16-10-25(12-23)9-8-14(16)11-26/h1-7,11H,8-10H2,(H,24,27).
What are the key properties of N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide?
N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide has a molecular weight of 367.36 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1-cyano-4-formyl-3,6-dihydro-2H-pyridin-5-yl)phenyl]-2,6-difluorobenzamide is sourced from PubChem (CID 89250978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).