C23H29BrCl2O6 — CID 160879823
1-bromo-4-chlorobutane;4-(4-chlorobutoxy)benzoic acid;methyl 4-hydroxybenzoate (PubChem CID 160879823) has the molecular formula C23H29BrCl2O6 and a molecular weight of 552.29 g/mol. Its IUPAC name is 1-bromo-4-chlorobutane;4-(4-chlorobutoxy)benzoic acid;methyl 4-hydroxybenzoate.
| Compound Name | 1-bromo-4-chlorobutane;4-(4-chlorobutoxy)benzoic acid;methyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 160879823 |
| Molecular Formula | C23H29BrCl2O6 |
| Molecular Weight | 552.29 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 1-bromo-4-chlorobutane;4-(4-chlorobutoxy)benzoic acid;methyl 4-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)cc1.ClCCCCBr.O=C(O)c1ccc(OCCCCCl)cc1 |
| InChI | InChI=1S/C11H13ClO3.C8H8O3.C4H8BrCl/c12-7-1-2-8-15-10-5-3-9(4-6-10)11(13)14;1-11-8(10)6-2-4-7(9)5-3-6;5-3-1-2-4-6/h3-6H,1-2,7-8H2,(H,13,14);2-5,9H,1H3;1-4H2 |
| InChIKey | SMWPUWOYSYFYNZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.29 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|