C43H52Cl2N6O2 — CID 160881817
bis(1-(1-adamantyl)-2-(10-chloro-4,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaen-7-yl)ethanol);methane (PubChem CID 160881817) has the molecular formula C43H52Cl2N6O2 and a molecular weight of 755.84 g/mol. Its IUPAC name is bis(1-(1-adamantyl)-2-(10-chloro-4,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaen-7-yl)ethanol);methane.
| Compound Name | bis(1-(1-adamantyl)-2-(10-chloro-4,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaen-7-yl)ethanol);methane |
|---|---|
| PubChem CID | 160881817 |
| Molecular Formula | C43H52Cl2N6O2 |
| Molecular Weight | 755.84 g/mol |
| Exact Mass | 754.35 |
| IUPAC Name | bis(1-(1-adamantyl)-2-(10-chloro-4,6,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaen-7-yl)ethanol);methane |
| SMILES | C.OC(CC1c2cc(Cl)ncc2-c2cncn21)C12CC3CC(CC(C3)C1)C2.OC(CC1c2cc(Cl)ncc2-c2cncn21)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/2C21H24ClN3O.CH4/c2*22-20-4-15-16(9-24-20)18-10-23-11-25(18)17(15)5-19(26)21-6-12-1-13(7-21)3-14(2-12)8-21;/h2*4,9-14,17,19,26H,1-3,5-8H2;1H4 |
| InChIKey | SNDBHHRZNOJBNH-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.84 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|