C11H14ClF2NO — CID 160883453
butan-1-amine;2,6-difluorobenzoyl chloride (PubChem CID 160883453) has the molecular formula C11H14ClF2NO and a molecular weight of 249.69 g/mol. Its IUPAC name is butan-1-amine;2,6-difluorobenzoyl chloride.
| Compound Name | butan-1-amine;2,6-difluorobenzoyl chloride |
|---|---|
| PubChem CID | 160883453 |
| Molecular Formula | C11H14ClF2NO |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | butan-1-amine;2,6-difluorobenzoyl chloride |
| SMILES | CCCCN.O=C(Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C7H3ClF2O.C4H11N/c8-7(11)6-4(9)2-1-3-5(6)10;1-2-3-4-5/h1-3H;2-5H2,1H3 |
| InChIKey | SNIBQCUYENGRAE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|