butan-1-amine;2,6-difluorobenzoyl chloride

C11H14ClF2NO — CID 160883453

IUPACbutan-1-amine;2,6-difluorobenzoyl chloride
SMILESCCCCN.O=C(Cl)c1c(F)cccc1F
InChIInChI=1S/C7H3ClF2O.C4H11N/c8-7(11)6-4(9)2-1-3-5(6)10;1-2-3-4-5/h1-3H;2-5H2,1H3
InChIKeySNIBQCUYENGRAE-UHFFFAOYSA-N
MW249.69 g/mol
LogP3.09
Rot. Bonds3

About butan-1-amine;2,6-difluorobenzoyl chloride

butan-1-amine;2,6-difluorobenzoyl chloride (PubChem CID 160883453) has the molecular formula C11H14ClF2NO and a molecular weight of 249.69 g/mol. Its IUPAC name is butan-1-amine;2,6-difluorobenzoyl chloride.

Molecular Properties

Compound Namebutan-1-amine;2,6-difluorobenzoyl chloride
PubChem CID160883453
Molecular FormulaC11H14ClF2NO
Molecular Weight249.69 g/mol
Exact Mass249.07
IUPAC Namebutan-1-amine;2,6-difluorobenzoyl chloride
SMILESCCCCN.O=C(Cl)c1c(F)cccc1F
InChIInChI=1S/C7H3ClF2O.C4H11N/c8-7(11)6-4(9)2-1-3-5(6)10;1-2-3-4-5/h1-3H;2-5H2,1H3
InChIKeySNIBQCUYENGRAE-UHFFFAOYSA-N
XLogP3.09
TPSA43.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.69
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze butan-1-amine;2,6-difluorobenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butan-1-amine;2,6-difluorobenzoyl chloride?
The IUPAC name of butan-1-amine;2,6-difluorobenzoyl chloride (CID 160883453) is butan-1-amine;2,6-difluorobenzoyl chloride.
What is the SMILES notation for butan-1-amine;2,6-difluorobenzoyl chloride?
The canonical SMILES for butan-1-amine;2,6-difluorobenzoyl chloride is CCCCN.O=C(Cl)c1c(F)cccc1F.
What is the InChIKey of butan-1-amine;2,6-difluorobenzoyl chloride?
The InChIKey is SNIBQCUYENGRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClF2O.C4H11N/c8-7(11)6-4(9)2-1-3-5(6)10;1-2-3-4-5/h1-3H;2-5H2,1H3.
What are the key properties of butan-1-amine;2,6-difluorobenzoyl chloride?
butan-1-amine;2,6-difluorobenzoyl chloride has a molecular weight of 249.69 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;2,6-difluorobenzoyl chloride is sourced from PubChem (CID 160883453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).