2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride

C21H24ClFO2 — CID 139793014

IUPAC2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride
SMILESCCCCCC(C)COc1ccc(-c2cccc(F)c2C(=O)Cl)cc1
InChIInChI=1S/C21H24ClFO2/c1-3-4-5-7-15(2)14-25-17-12-10-16(11-13-17)18-8-6-9-19(23)20(18)21(22)24/h6,8-13,15H,3-5,7,14H2,1-2H3
InChIKeyHIYNAZLSTBYELQ-UHFFFAOYSA-N
MW362.87 g/mol
LogP6.47
Rot. Bonds9

About 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride

2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride (PubChem CID 139793014) has the molecular formula C21H24ClFO2 and a molecular weight of 362.87 g/mol. Its IUPAC name is 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride.

Molecular Properties

Compound Name2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride
PubChem CID139793014
Molecular FormulaC21H24ClFO2
Molecular Weight362.87 g/mol
Exact Mass362.14
IUPAC Name2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride
SMILESCCCCCC(C)COc1ccc(-c2cccc(F)c2C(=O)Cl)cc1
InChIInChI=1S/C21H24ClFO2/c1-3-4-5-7-15(2)14-25-17-12-10-16(11-13-17)18-8-6-9-19(23)20(18)21(22)24/h6,8-13,15H,3-5,7,14H2,1-2H3
InChIKeyHIYNAZLSTBYELQ-UHFFFAOYSA-N
XLogP6.47
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500362.87
LogP ≤ 56.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride?
The IUPAC name of 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride (CID 139793014) is 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride.
What is the SMILES notation for 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride?
The canonical SMILES for 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride is CCCCCC(C)COc1ccc(-c2cccc(F)c2C(=O)Cl)cc1.
What is the InChIKey of 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride?
The InChIKey is HIYNAZLSTBYELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24ClFO2/c1-3-4-5-7-15(2)14-25-17-12-10-16(11-13-17)18-8-6-9-19(23)20(18)21(22)24/h6,8-13,15H,3-5,7,14H2,1-2H3.
What are the key properties of 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride?
2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride has a molecular weight of 362.87 g/mol, XLogP of 6.47, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-[4-(2-methylheptoxy)phenyl]benzoyl chloride is sourced from PubChem (CID 139793014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).