C20H20ClNO — CID 160883901
(1E)-1-(3-chlorophenyl)-4-[(dimethylamino)methyl]-2-phenylpenta-1,4-dien-3-one (PubChem CID 160883901) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is (1E)-1-(3-chlorophenyl)-4-[(dimethylamino)methyl]-2-phenylpenta-1,4-dien-3-one.
| Compound Name | (1E)-1-(3-chlorophenyl)-4-[(dimethylamino)methyl]-2-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 160883901 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (1E)-1-(3-chlorophenyl)-4-[(dimethylamino)methyl]-2-phenylpenta-1,4-dien-3-one |
| SMILES | C=C(CN(C)C)C(=O)/C(=C/c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C20H20ClNO/c1-15(14-22(2)3)20(23)19(17-9-5-4-6-10-17)13-16-8-7-11-18(21)12-16/h4-13H,1,14H2,2-3H3/b19-13+ |
| InChIKey | ZDSSXWIAXXJLLR-CPNJWEJPSA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|