C27H27NO — CID 161334450
(1E)-4-[[benzyl(methyl)amino]methyl]-1-(3-methylphenyl)-2-phenylpenta-1,4-dien-3-one (PubChem CID 161334450) has the molecular formula C27H27NO and a molecular weight of 381.52 g/mol. Its IUPAC name is (1E)-4-[[benzyl(methyl)amino]methyl]-1-(3-methylphenyl)-2-phenylpenta-1,4-dien-3-one.
| Compound Name | (1E)-4-[[benzyl(methyl)amino]methyl]-1-(3-methylphenyl)-2-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 161334450 |
| Molecular Formula | C27H27NO |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (1E)-4-[[benzyl(methyl)amino]methyl]-1-(3-methylphenyl)-2-phenylpenta-1,4-dien-3-one |
| SMILES | C=C(CN(C)Cc1ccccc1)C(=O)/C(=C/c1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C27H27NO/c1-21-11-10-14-24(17-21)18-26(25-15-8-5-9-16-25)27(29)22(2)19-28(3)20-23-12-6-4-7-13-23/h4-18H,2,19-20H2,1,3H3/b26-18+ |
| InChIKey | VLVNKNZMDIYFRS-NLRVBDNBSA-N |
| XLogP | 5.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|