C26H26ClNO — CID 162328423
(1E)-4-[[benzyl(methyl)amino]methyl]-1,2-diphenylpenta-1,4-dien-3-one;hydrochloride (PubChem CID 162328423) has the molecular formula C26H26ClNO and a molecular weight of 403.95 g/mol. Its IUPAC name is (1E)-4-[[benzyl(methyl)amino]methyl]-1,2-diphenylpenta-1,4-dien-3-one;hydrochloride.
| Compound Name | (1E)-4-[[benzyl(methyl)amino]methyl]-1,2-diphenylpenta-1,4-dien-3-one;hydrochloride |
|---|---|
| PubChem CID | 162328423 |
| Molecular Formula | C26H26ClNO |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (1E)-4-[[benzyl(methyl)amino]methyl]-1,2-diphenylpenta-1,4-dien-3-one;hydrochloride |
| SMILES | C=C(CN(C)Cc1ccccc1)C(=O)/C(=C/c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C26H25NO.ClH/c1-21(19-27(2)20-23-14-8-4-9-15-23)26(28)25(24-16-10-5-11-17-24)18-22-12-6-3-7-13-22;/h3-18H,1,19-20H2,2H3;1H/b25-18+; |
| InChIKey | BAFYNCLLZKDXBP-LHSXHHQOSA-N |
| XLogP | 5.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|