C26H22F3N7O6S — CID 160890568
N,3-dimethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide;3-(methylamino)-4-nitrobenzoic acid (PubChem CID 160890568) has the molecular formula C26H22F3N7O6S and a molecular weight of 617.57 g/mol. Its IUPAC name is N,3-dimethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide;3-(methylamino)-4-nitrobenzoic acid.
| Compound Name | N,3-dimethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide;3-(methylamino)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 160890568 |
| Molecular Formula | C26H22F3N7O6S |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | N,3-dimethyl-2-[[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]amino]benzimidazole-5-carboxamide;3-(methylamino)-4-nitrobenzoic acid |
| SMILES | CNC(=O)c1ccc2nc(Nc3nc4ccc(OC(F)(F)F)cc4s3)n(C)c2c1.CNc1cc(C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14F3N5O2S.C8H8N2O4/c1-22-15(27)9-3-5-11-13(7-9)26(2)16(23-11)25-17-24-12-6-4-10(8-14(12)29-17)28-18(19,20)21;1-9-6-4-5(8(11)12)2-3-7(6)10(13)14/h3-8H,1-2H3,(H,22,27)(H,23,24,25);2-4,9H,1H3,(H,11,12) |
| InChIKey | SOFGVUIKKUHMQG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 173.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|