C31H25ClN2O2 — CID 160895191
1,3-dibenzyl-5-(4-chlorophenyl)-6-(4-methylphenyl)pyrimidine-2,4-dione (PubChem CID 160895191) has the molecular formula C31H25ClN2O2 and a molecular weight of 493.01 g/mol. Its IUPAC name is 1,3-dibenzyl-5-(4-chlorophenyl)-6-(4-methylphenyl)pyrimidine-2,4-dione.
| Compound Name | 1,3-dibenzyl-5-(4-chlorophenyl)-6-(4-methylphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 160895191 |
| Molecular Formula | C31H25ClN2O2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 1,3-dibenzyl-5-(4-chlorophenyl)-6-(4-methylphenyl)pyrimidine-2,4-dione |
| SMILES | Cc1ccc(-c2c(-c3ccc(Cl)cc3)c(=O)n(Cc3ccccc3)c(=O)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H25ClN2O2/c1-22-12-14-26(15-13-22)29-28(25-16-18-27(32)19-17-25)30(35)34(21-24-10-6-3-7-11-24)31(36)33(29)20-23-8-4-2-5-9-23/h2-19H,20-21H2,1H3 |
| InChIKey | LHORKNGRGNJPSB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |