C26H38O8 — CID 160900596
bis(carbon dioxide);[(1R,3S,4R,8R)-8-ethyl-4-(4-hydroxy-4-methylhex-5-en-2-yl)-3,4,8-trimethyl-7-oxo-2,3,5,6-tetrahydro-1H-naphthalen-1-yl] acetate (PubChem CID 160900596) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is bis(carbon dioxide);[(1R,3S,4R,8R)-8-ethyl-4-(4-hydroxy-4-methylhex-5-en-2-yl)-3,4,8-trimethyl-7-oxo-2,3,5,6-tetrahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | bis(carbon dioxide);[(1R,3S,4R,8R)-8-ethyl-4-(4-hydroxy-4-methylhex-5-en-2-yl)-3,4,8-trimethyl-7-oxo-2,3,5,6-tetrahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 160900596 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | bis(carbon dioxide);[(1R,3S,4R,8R)-8-ethyl-4-(4-hydroxy-4-methylhex-5-en-2-yl)-3,4,8-trimethyl-7-oxo-2,3,5,6-tetrahydro-1H-naphthalen-1-yl] acetate |
| SMILES | C=CC(C)(O)CC(C)[C@]1(C)C2=C([C@H](OC(C)=O)C[C@@H]1C)[C@@](C)(CC)C(=O)CC2.O=C=O.O=C=O |
| InChI | InChI=1S/C24H38O4.2CO2/c1-9-22(6,27)14-16(4)24(8)15(3)13-19(28-17(5)25)21-18(24)11-12-20(26)23(21,7)10-2;2*2-1-3/h9,15-16,19,27H,1,10-14H2,2-8H3;;/t15-,16?,19+,22?,23-,24+;;/m0../s1 |
| InChIKey | SPLIMQMGUGYAKS-PJOXXCJBSA-N |
| XLogP | 3.84 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|