C28H23Cl2F2N3O9 — CID 160902286
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloropyridin-1-ium-4-yl)ethyl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate hydroxide (PubChem CID 160902286) has the molecular formula C28H23Cl2F2N3O9 and a molecular weight of 654.41 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloropyridin-1-ium-4-yl)ethyl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate hydroxide.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloropyridin-1-ium-4-yl)ethyl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate hydroxide |
|---|---|
| PubChem CID | 160902286 |
| Molecular Formula | C28H23Cl2F2N3O9 |
| Molecular Weight | 654.41 g/mol |
| Exact Mass | 653.08 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloropyridin-1-ium-4-yl)ethyl] 2-(5-nitro-1,3-dioxoisoindol-2-yl)acetate hydroxide |
| SMILES | O=C(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)O[C@@H](Cc1c(Cl)c[nH+]cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1.[OH-] |
| InChI | InChI=1S/C28H21Cl2F2N3O8.H2O/c29-20-10-33-11-21(30)19(20)9-23(15-3-6-22(43-28(31)32)24(7-15)41-13-14-1-2-14)42-25(36)12-34-26(37)17-5-4-16(35(39)40)8-18(17)27(34)38;/h3-8,10-11,14,23,28H,1-2,9,12-13H2;1H2/t23-;/m0./s1 |
| InChIKey | CKSNJRNVJIAXNB-BQAIUKQQSA-N |
| XLogP | 5.05 |
| TPSA | 169.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|