About (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride
(4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride (PubChem CID 160903843) has the molecular formula C15H16ClF2N5
and a molecular weight of 339.78 g/mol. Its IUPAC name is (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride |
| PubChem CID | 160903843 |
| Molecular Formula | C15H16ClF2N5 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride |
| SMILES | Cl.NNc1ccc(F)cc1.Nc1ccnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C9H8FN3.C6H7FN2.ClH/c10-7-1-3-8(4-2-7)13-9(11)5-6-12-13;7-5-1-3-6(9-8)4-2-5;/h1-6H,11H2;1-4,9H,8H2;1H |
| InChIKey | SPWCTLKHOUCROY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride?
The IUPAC name of (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride (CID 160903843) is (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride.
What is the SMILES notation for (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride?
The canonical SMILES for (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride is Cl.NNc1ccc(F)cc1.Nc1ccnn1-c1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride?
The InChIKey is SPWCTLKHOUCROY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3.C6H7FN2.ClH/c10-7-1-3-8(4-2-7)13-9(11)5-6-12-13;7-5-1-3-6(9-8)4-2-5;/h1-6H,11H2;1-4,9H,8H2;1H.
What are the key properties of (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride?
(4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride has a molecular weight of 339.78 g/mol, XLogP of 3.13, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)hydrazine;2-(4-fluorophenyl)pyrazol-3-amine;hydrochloride is sourced from PubChem (CID 160903843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).