About 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide
4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 160908459) has the molecular formula C16H22F3N5O
and a molecular weight of 357.38 g/mol. Its IUPAC name is 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
| PubChem CID | 160908459 |
| Molecular Formula | C16H22F3N5O |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | CCOC1CCN(C(N)=N/C(N)=N/c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H22F3N5O/c1-2-25-13-6-8-24(9-7-13)15(21)23-14(20)22-12-5-3-4-11(10-12)16(17,18)19/h3-5,10,13H,2,6-9H2,1H3,(H4,20,21,22,23) |
| InChIKey | SQLMTXINFGQWGW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide?
The IUPAC name of 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide (CID 160908459) is 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide.
What is the SMILES notation for 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide?
The canonical SMILES for 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide is CCOC1CCN(C(N)=N/C(N)=N/c2cccc(C(F)(F)F)c2)CC1.
What is the InChIKey of 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide?
The InChIKey is SQLMTXINFGQWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F3N5O/c1-2-25-13-6-8-24(9-7-13)15(21)23-14(20)22-12-5-3-4-11(10-12)16(17,18)19/h3-5,10,13H,2,6-9H2,1H3,(H4,20,21,22,23).
What are the key properties of 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide?
4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide has a molecular weight of 357.38 g/mol, XLogP of 2.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N'-[N'-[3-(trifluoromethyl)phenyl]carbamimidoyl]piperidine-1-carboximidamide is sourced from PubChem (CID 160908459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).