About magnesium;dioxosilane;carbonate
magnesium;dioxosilane;carbonate (PubChem CID 160910318) has the molecular formula CMgO5Si
and a molecular weight of 144.40 g/mol. Its IUPAC name is magnesium;dioxosilane;carbonate.
Molecular Properties
| Compound Name | magnesium;dioxosilane;carbonate |
| PubChem CID | 160910318 |
| Molecular Formula | CMgO5Si |
| Molecular Weight | 144.40 g/mol |
| Exact Mass | 143.94 |
| IUPAC Name | magnesium;dioxosilane;carbonate |
| SMILES | O=C([O-])[O-].O=[Si]=O.[Mg+2] |
| InChI | InChI=1S/CH2O3.Mg.O2Si/c2-1(3)4;;1-3-2/h(H2,2,3,4);;/q;+2;/p-2 |
| InChIKey | SQRNXCQDAYRNTN-UHFFFAOYSA-L |
| XLogP | -3.45 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.40 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;dioxosilane;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;dioxosilane;carbonate?
The IUPAC name of magnesium;dioxosilane;carbonate (CID 160910318) is magnesium;dioxosilane;carbonate.
What is the SMILES notation for magnesium;dioxosilane;carbonate?
The canonical SMILES for magnesium;dioxosilane;carbonate is O=C([O-])[O-].O=[Si]=O.[Mg+2].
What is the InChIKey of magnesium;dioxosilane;carbonate?
The InChIKey is SQRNXCQDAYRNTN-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Mg.O2Si/c2-1(3)4;;1-3-2/h(H2,2,3,4);;/q;+2;/p-2.
What are the key properties of magnesium;dioxosilane;carbonate?
magnesium;dioxosilane;carbonate has a molecular weight of 144.40 g/mol, XLogP of -3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;dioxosilane;carbonate is sourced from PubChem (CID 160910318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).