About 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile
4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile (PubChem CID 160920367) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile |
| PubChem CID | 160920367 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)Nc1ccc(O)cc1.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12N2O.C6H7NO/c1-10(2,7-11)12-8-3-5-9(13)6-4-8;7-5-1-3-6(8)4-2-5/h3-6,12-13H,1-2H3;1-4,8H,7H2 |
| InChIKey | SRYGNLRMYWPDIF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile?
The IUPAC name of 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile (CID 160920367) is 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile.
What is the SMILES notation for 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile?
The canonical SMILES for 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile is CC(C)(C#N)Nc1ccc(O)cc1.Nc1ccc(O)cc1.
What is the InChIKey of 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile?
The InChIKey is SRYGNLRMYWPDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O.C6H7NO/c1-10(2,7-11)12-8-3-5-9(13)6-4-8;7-5-1-3-6(8)4-2-5/h3-6,12-13H,1-2H3;1-4,8H,7H2.
What are the key properties of 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile?
4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile has a molecular weight of 285.35 g/mol, XLogP of 3.08, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminophenol;2-(4-hydroxyanilino)-2-methylpropanenitrile is sourced from PubChem (CID 160920367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).