C36H39N6O8+ — CID 160927055
(2,4-dioxo-4-phenylbutanoyl)-methylideneoxidanium;methylhydrazine;methyl 1-methyl-3-phenylpyrazole-5-carboxylate;methyl 1-methyl-5-phenylpyrazole-3-carboxylate (PubChem CID 160927055) has the molecular formula C36H39N6O8+ and a molecular weight of 683.74 g/mol. Its IUPAC name is (2,4-dioxo-4-phenylbutanoyl)-methylideneoxidanium;methylhydrazine;methyl 1-methyl-3-phenylpyrazole-5-carboxylate;methyl 1-methyl-5-phenylpyrazole-3-carboxylate.
| Compound Name | (2,4-dioxo-4-phenylbutanoyl)-methylideneoxidanium;methylhydrazine;methyl 1-methyl-3-phenylpyrazole-5-carboxylate;methyl 1-methyl-5-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 160927055 |
| Molecular Formula | C36H39N6O8+ |
| Molecular Weight | 683.74 g/mol |
| Exact Mass | 683.28 |
| IUPAC Name | (2,4-dioxo-4-phenylbutanoyl)-methylideneoxidanium;methylhydrazine;methyl 1-methyl-3-phenylpyrazole-5-carboxylate;methyl 1-methyl-5-phenylpyrazole-3-carboxylate |
| SMILES | C=[O+]C(=O)C(=O)CC(=O)c1ccccc1.CNN.COC(=O)c1cc(-c2ccccc2)n(C)n1.COC(=O)c1cc(-c2ccccc2)nn1C |
| InChI | InChI=1S/2C12H12N2O2.C11H9O4.CH6N2/c1-14-11(9-6-4-3-5-7-9)8-10(13-14)12(15)16-2;1-14-11(12(15)16-2)8-10(13-14)9-6-4-3-5-7-9;1-15-11(14)10(13)7-9(12)8-5-3-2-4-6-8;1-3-2/h2*3-8H,1-2H3;2-6H,1,7H2;3H,2H2,1H3/q;;+1; |
| InChIKey | SSTWVQXCUOHIPX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 188.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|