C33H37N9O8 — CID 158639106
methyl 2,4-dioxo-4-pyridin-3-ylbutanoate;methylhydrazine;methyl 1-methyl-3-pyridin-3-ylpyrazole-5-carboxylate;methyl 1-methyl-5-pyridin-3-ylpyrazole-3-carboxylate (PubChem CID 158639106) has the molecular formula C33H37N9O8 and a molecular weight of 687.71 g/mol. Its IUPAC name is methyl 2,4-dioxo-4-pyridin-3-ylbutanoate;methylhydrazine;methyl 1-methyl-3-pyridin-3-ylpyrazole-5-carboxylate;methyl 1-methyl-5-pyridin-3-ylpyrazole-3-carboxylate.
| Compound Name | methyl 2,4-dioxo-4-pyridin-3-ylbutanoate;methylhydrazine;methyl 1-methyl-3-pyridin-3-ylpyrazole-5-carboxylate;methyl 1-methyl-5-pyridin-3-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 158639106 |
| Molecular Formula | C33H37N9O8 |
| Molecular Weight | 687.71 g/mol |
| Exact Mass | 687.28 |
| IUPAC Name | methyl 2,4-dioxo-4-pyridin-3-ylbutanoate;methylhydrazine;methyl 1-methyl-3-pyridin-3-ylpyrazole-5-carboxylate;methyl 1-methyl-5-pyridin-3-ylpyrazole-3-carboxylate |
| SMILES | CNN.COC(=O)C(=O)CC(=O)c1cccnc1.COC(=O)c1cc(-c2cccnc2)n(C)n1.COC(=O)c1cc(-c2cccnc2)nn1C |
| InChI | InChI=1S/2C11H11N3O2.C10H9NO4.CH6N2/c1-14-10(8-4-3-5-12-7-8)6-9(13-14)11(15)16-2;1-14-10(11(15)16-2)6-9(13-14)8-4-3-5-12-7-8;1-15-10(14)9(13)5-8(12)7-3-2-4-11-6-7;1-3-2/h2*3-7H,1-2H3;2-4,6H,5H2,1H3;3H,2H2,1H3 |
| InChIKey | IADLUZDWEXBACN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 225.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.71 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|