C19H30O2 — CID 160931073
1-(2,3-dimethyl-4-oct-7-enoxyphenyl)ethanone;methane (PubChem CID 160931073) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-(2,3-dimethyl-4-oct-7-enoxyphenyl)ethanone;methane.
| Compound Name | 1-(2,3-dimethyl-4-oct-7-enoxyphenyl)ethanone;methane |
|---|---|
| PubChem CID | 160931073 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-(2,3-dimethyl-4-oct-7-enoxyphenyl)ethanone;methane |
| SMILES | C.C=CCCCCCCOc1ccc(C(C)=O)c(C)c1C |
| InChI | InChI=1S/C18H26O2.CH4/c1-5-6-7-8-9-10-13-20-18-12-11-17(16(4)19)14(2)15(18)3;/h5,11-12H,1,6-10,13H2,2-4H3;1H4 |
| InChIKey | STGUCRCUAKIAIG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|