C17H22O4 — CID 54151308
6-(4-acetyl-5-hydroxy-2-prop-2-enylphenoxy)hexanal (PubChem CID 54151308) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 6-(4-acetyl-5-hydroxy-2-prop-2-enylphenoxy)hexanal.
| Compound Name | 6-(4-acetyl-5-hydroxy-2-prop-2-enylphenoxy)hexanal |
|---|---|
| PubChem CID | 54151308 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 6-(4-acetyl-5-hydroxy-2-prop-2-enylphenoxy)hexanal |
| SMILES | C=CCc1cc(C(C)=O)c(O)cc1OCCCCCC=O |
| InChI | InChI=1S/C17H22O4/c1-3-8-14-11-15(13(2)19)16(20)12-17(14)21-10-7-5-4-6-9-18/h3,9,11-12,20H,1,4-8,10H2,2H3 |
| InChIKey | QOOHMRFVLUPDRJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|