C18H25NO3 — CID 15747301
6-(4-acetyl-2-ethyl-5-hydroxyphenoxy)-2,2-dimethylhexanenitrile (PubChem CID 15747301) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 6-(4-acetyl-2-ethyl-5-hydroxyphenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-acetyl-2-ethyl-5-hydroxyphenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 15747301 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 6-(4-acetyl-2-ethyl-5-hydroxyphenoxy)-2,2-dimethylhexanenitrile |
| SMILES | CCc1cc(C(C)=O)c(O)cc1OCCCCC(C)(C)C#N |
| InChI | InChI=1S/C18H25NO3/c1-5-14-10-15(13(2)20)16(21)11-17(14)22-9-7-6-8-18(3,4)12-19/h10-11,21H,5-9H2,1-4H3 |
| InChIKey | KVEHYUOESOIAKD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|