About ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium
ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium (PubChem CID 160932383) has the molecular formula C14H28NO2P+2
and a molecular weight of 273.36 g/mol. Its IUPAC name is ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium.
Molecular Properties
| Compound Name | ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium |
| PubChem CID | 160932383 |
| Molecular Formula | C14H28NO2P+2 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium |
| SMILES | CC.COC(=O)c1cccc[n+]1C.C[P+](C)(C)C |
| InChI | InChI=1S/C8H10NO2.C4H12P.C2H6/c1-9-6-4-3-5-7(9)8(10)11-2;1-5(2,3)4;1-2/h3-6H,1-2H3;1-4H3;1-2H3/q2*+1; |
| InChIKey | VCLFJJSVLFMSSL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium?
The IUPAC name of ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium (CID 160932383) is ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium.
What is the SMILES notation for ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium?
The canonical SMILES for ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium is CC.COC(=O)c1cccc[n+]1C.C[P+](C)(C)C.
What is the InChIKey of ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium?
The InChIKey is VCLFJJSVLFMSSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO2.C4H12P.C2H6/c1-9-6-4-3-5-7(9)8(10)11-2;1-5(2,3)4;1-2/h3-6H,1-2H3;1-4H3;1-2H3/q2*+1;.
What are the key properties of ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium?
ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium has a molecular weight of 273.36 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 1-methylpyridin-1-ium-2-carboxylate;tetramethylphosphanium is sourced from PubChem (CID 160932383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).