C26H30NO2+ — CID 176787511
methyl 1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyridin-1-ium-2-carboxylate (PubChem CID 176787511) has the molecular formula C26H30NO2+ and a molecular weight of 388.53 g/mol. Its IUPAC name is methyl 1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyridin-1-ium-2-carboxylate.
| Compound Name | methyl 1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 176787511 |
| Molecular Formula | C26H30NO2+ |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | methyl 1-methyl-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]pyridin-1-ium-2-carboxylate |
| SMILES | COC(=O)c1c(-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)ccc[n+]1C |
| InChI | InChI=1S/C26H30NO2/c1-17(2)22-15-20(19-11-8-7-9-12-19)16-23(18(3)4)24(22)21-13-10-14-27(5)25(21)26(28)29-6/h7-18H,1-6H3/q+1 |
| InChIKey | XFIKPDMGVCXVRU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|