C42H53O5P — CID 160937449
dioctyl benzene-1,2-dicarboxylate;diphenylphosphorylbenzene (PubChem CID 160937449) has the molecular formula C42H53O5P and a molecular weight of 668.86 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;diphenylphosphorylbenzene.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;diphenylphosphorylbenzene |
|---|---|
| PubChem CID | 160937449 |
| Molecular Formula | C42H53O5P |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;diphenylphosphorylbenzene |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.O=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H38O4.C18H15OP/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1-15H |
| InChIKey | SUBFITRUTPJTNM-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|