About 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine
3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine (PubChem CID 160944147) has the molecular formula C24H28Br2N6O2
and a molecular weight of 592.34 g/mol. Its IUPAC name is 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine |
| PubChem CID | 160944147 |
| Molecular Formula | C24H28Br2N6O2 |
| Molecular Weight | 592.34 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine |
| SMILES | Brc1cnc2ncc(OC3CCCCC3)cn12.Brc1cnc2ncc(OC3CCCCC3)cn12 |
| InChI | InChI=1S/2C12H14BrN3O/c2*13-11-7-15-12-14-6-10(8-16(11)12)17-9-4-2-1-3-5-9/h2*6-9H,1-5H2 |
| InChIKey | SUWVDBULJIGISY-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.34 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine?
The IUPAC name of 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine (CID 160944147) is 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine.
What is the SMILES notation for 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine?
The canonical SMILES for 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine is Brc1cnc2ncc(OC3CCCCC3)cn12.Brc1cnc2ncc(OC3CCCCC3)cn12.
What is the InChIKey of 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine?
The InChIKey is SUWVDBULJIGISY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H14BrN3O/c2*13-11-7-15-12-14-6-10(8-16(11)12)17-9-4-2-1-3-5-9/h2*6-9H,1-5H2.
What are the key properties of 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine?
3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine has a molecular weight of 592.34 g/mol, XLogP of 6.41, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-cyclohexyloxyimidazo[1,2-a]pyrimidine is sourced from PubChem (CID 160944147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).