C18H20N2O5 — CID 160944392
1-(1H-pyrrol-3-yl)butane-1,3-dione;1-(1H-pyrrol-3-yl)hexane-1,3,5-trione (PubChem CID 160944392) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-(1H-pyrrol-3-yl)butane-1,3-dione;1-(1H-pyrrol-3-yl)hexane-1,3,5-trione.
| Compound Name | 1-(1H-pyrrol-3-yl)butane-1,3-dione;1-(1H-pyrrol-3-yl)hexane-1,3,5-trione |
|---|---|
| PubChem CID | 160944392 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-(1H-pyrrol-3-yl)butane-1,3-dione;1-(1H-pyrrol-3-yl)hexane-1,3,5-trione |
| SMILES | CC(=O)CC(=O)CC(=O)c1cc[nH]c1.CC(=O)CC(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C10H11NO3.C8H9NO2/c1-7(12)4-9(13)5-10(14)8-2-3-11-6-8;1-6(10)4-8(11)7-2-3-9-5-7/h2-3,6,11H,4-5H2,1H3;2-3,5,9H,4H2,1H3 |
| InChIKey | SUXQXVYXZOAFOC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|