C10H10F4N2 — CID 160947057
methane;2,2,5,6-tetrafluoro-4,7-dimethylbenzimidazole (PubChem CID 160947057) has the molecular formula C10H10F4N2 and a molecular weight of 234.20 g/mol. Its IUPAC name is methane;2,2,5,6-tetrafluoro-4,7-dimethylbenzimidazole.
| Compound Name | methane;2,2,5,6-tetrafluoro-4,7-dimethylbenzimidazole |
|---|---|
| PubChem CID | 160947057 |
| Molecular Formula | C10H10F4N2 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | methane;2,2,5,6-tetrafluoro-4,7-dimethylbenzimidazole |
| SMILES | C.Cc1c(F)c(F)c(C)c2c1=NC(F)(F)N=2 |
| InChI | InChI=1S/C9H6F4N2.CH4/c1-3-5(10)6(11)4(2)8-7(3)14-9(12,13)15-8;/h1-2H3;1H4 |
| InChIKey | SVGJZZHCQZTNRF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|