C10H11N2Y- — CID 147967586
4,6,7-trimethyl-2,5-dihydrobenzimidazol-5-ide;yttrium (PubChem CID 147967586) has the molecular formula C10H11N2Y- and a molecular weight of 248.12 g/mol. Its IUPAC name is 4,6,7-trimethyl-2,5-dihydrobenzimidazol-5-ide;yttrium.
| Compound Name | 4,6,7-trimethyl-2,5-dihydrobenzimidazol-5-ide;yttrium |
|---|---|
| PubChem CID | 147967586 |
| Molecular Formula | C10H11N2Y- |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 4,6,7-trimethyl-2,5-dihydrobenzimidazol-5-ide;yttrium |
| SMILES | Cc1[c-]c(C)c2c(c1C)=NCN=2.[Y] |
| InChI | InChI=1S/C10H11N2.Y/c1-6-4-7(2)9-10(8(6)3)12-5-11-9;/h5H2,1-3H3;/q-1; |
| InChIKey | SDEPFOKBQSEVEQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|