C10H12N2 — CID 59646218
4,5,6-trimethyl-2H-benzimidazole (PubChem CID 59646218) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 4,5,6-trimethyl-2H-benzimidazole.
| Compound Name | 4,5,6-trimethyl-2H-benzimidazole |
|---|---|
| PubChem CID | 59646218 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4,5,6-trimethyl-2H-benzimidazole |
| SMILES | Cc1cc2c(c(C)c1C)=NCN=2 |
| InChI | InChI=1S/C10H12N2/c1-6-4-9-10(12-5-11-9)8(3)7(6)2/h4H,5H2,1-3H3 |
| InChIKey | CISQKOUBDNMJIO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |