C25H39ClGeN3P — CID 160950369
CID 160950369 (PubChem CID 160950369) has the molecular formula C25H39ClGeN3P and a molecular weight of 520.65 g/mol.
| Compound Name | CID 160950369 |
|---|---|
| PubChem CID | 160950369 |
| Molecular Formula | C25H39ClGeN3P |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C(C)C)c1N([Ge]Cl)C1=C(P2N(C(C)C)CCN2C(C)C)C2CCC1C2 |
| InChI | InChI=1S/C25H39ClGeN3P/c1-16(2)22-10-8-9-19(7)23(22)30(27-26)24-20-11-12-21(15-20)25(24)31-28(17(3)4)13-14-29(31)18(5)6/h8-10,16-18,20-21H,11-15H2,1-7H3 |
| InChIKey | PTEMUUVNUCPUJM-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|