C47H58N3PSi — CID 139114707
(3R,6S,9R)-8-[2,6-di(propan-2-yl)phenyl]-9,14,15-triphenyl-10,13-di(propan-2-yl)-8,10,13-triaza-1-phospha-9-silatetracyclo[7.4.2.13,6.02,7]hexadeca-2(7),14-diene (PubChem CID 139114707) has the molecular formula C47H58N3PSi and a molecular weight of 724.06 g/mol. Its IUPAC name is (3R,6S,9R)-8-[2,6-di(propan-2-yl)phenyl]-9,14,15-triphenyl-10,13-di(propan-2-yl)-8,10,13-triaza-1-phospha-9-silatetracyclo[7.4.2.13,6.02,7]hexadeca-2(7),14-diene.
| Compound Name | (3R,6S,9R)-8-[2,6-di(propan-2-yl)phenyl]-9,14,15-triphenyl-10,13-di(propan-2-yl)-8,10,13-triaza-1-phospha-9-silatetracyclo[7.4.2.13,6.02,7]hexadeca-2(7),14-diene |
|---|---|
| PubChem CID | 139114707 |
| Molecular Formula | C47H58N3PSi |
| Molecular Weight | 724.06 g/mol |
| Exact Mass | 723.41 |
| IUPAC Name | (3R,6S,9R)-8-[2,6-di(propan-2-yl)phenyl]-9,14,15-triphenyl-10,13-di(propan-2-yl)-8,10,13-triaza-1-phospha-9-silatetracyclo[7.4.2.13,6.02,7]hexadeca-2(7),14-diene |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C2=C([C@@H]3CC[C@H]2C3)P2C(c3ccccc3)=C(c3ccccc3)[Si@]1(c1ccccc1)N(C(C)C)CCN2C(C)C |
| InChI | InChI=1S/C47H58N3PSi/c1-32(2)41-25-18-26-42(33(3)4)44(41)50-43-38-27-28-39(31-38)45(43)51-46(36-19-12-9-13-20-36)47(37-21-14-10-15-22-37)52(50,40-23-16-11-17-24-40)49(35(7)8)30-29-48(51)34(5)6/h9-26,32-35,38-39H,27-31H2,1-8H3/t38-,39+,51?,52+/m0/s1 |
| InChIKey | BOFKOHWOZMEGKL-UWSHVOAXSA-N |
| XLogP | 11.68 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.06 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|