About 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane
4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane (PubChem CID 160953319) has the molecular formula C17H32ClO3PS
and a molecular weight of 382.93 g/mol. Its IUPAC name is 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane.
Molecular Properties
| Compound Name | 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane |
| PubChem CID | 160953319 |
| Molecular Formula | C17H32ClO3PS |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane |
| SMILES | C.CCCCCC(CC)(CC)P(=O)(O)O.Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H23O3P.C6H5ClS.CH4/c1-4-7-8-9-10(5-2,6-3)14(11,12)13;7-5-1-3-6(8)4-2-5;/h4-9H2,1-3H3,(H2,11,12,13);1-4,8H;1H4 |
| InChIKey | WITGHOXBTRXVOI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane?
The IUPAC name of 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane (CID 160953319) is 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane.
What is the SMILES notation for 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane?
The canonical SMILES for 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane is C.CCCCCC(CC)(CC)P(=O)(O)O.Sc1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane?
The InChIKey is WITGHOXBTRXVOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23O3P.C6H5ClS.CH4/c1-4-7-8-9-10(5-2,6-3)14(11,12)13;7-5-1-3-6(8)4-2-5;/h4-9H2,1-3H3,(H2,11,12,13);1-4,8H;1H4.
What are the key properties of 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane?
4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane has a molecular weight of 382.93 g/mol, XLogP of 6.57, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzenethiol;3-ethyloctan-3-ylphosphonic acid;methane is sourced from PubChem (CID 160953319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).