C19H33N2O4P — CID 158088035
3-ethyloctan-3-ylphosphonic acid;2-imidazo[1,2-a]pyridin-3-ylethanol (PubChem CID 158088035) has the molecular formula C19H33N2O4P and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-ethyloctan-3-ylphosphonic acid;2-imidazo[1,2-a]pyridin-3-ylethanol.
| Compound Name | 3-ethyloctan-3-ylphosphonic acid;2-imidazo[1,2-a]pyridin-3-ylethanol |
|---|---|
| PubChem CID | 158088035 |
| Molecular Formula | C19H33N2O4P |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 3-ethyloctan-3-ylphosphonic acid;2-imidazo[1,2-a]pyridin-3-ylethanol |
| SMILES | CCCCCC(CC)(CC)P(=O)(O)O.OCCc1cnc2ccccn12 |
| InChI | InChI=1S/C10H23O3P.C9H10N2O/c1-4-7-8-9-10(5-2,6-3)14(11,12)13;12-6-4-8-7-10-9-3-1-2-5-11(8)9/h4-9H2,1-3H3,(H2,11,12,13);1-3,5,7,12H,4,6H2 |
| InChIKey | FNTFQTMNGYLYJO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|