C22H27NO5S — CID 160955841
3-ethyl-2-(4-methoxyphenyl)sulfonyl-5-methyl-2-(pyridin-3-ylmethyl)hex-4-enoic acid (PubChem CID 160955841) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is 3-ethyl-2-(4-methoxyphenyl)sulfonyl-5-methyl-2-(pyridin-3-ylmethyl)hex-4-enoic acid.
| Compound Name | 3-ethyl-2-(4-methoxyphenyl)sulfonyl-5-methyl-2-(pyridin-3-ylmethyl)hex-4-enoic acid |
|---|---|
| PubChem CID | 160955841 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-ethyl-2-(4-methoxyphenyl)sulfonyl-5-methyl-2-(pyridin-3-ylmethyl)hex-4-enoic acid |
| SMILES | CCC(C=C(C)C)C(Cc1cccnc1)(C(=O)O)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27NO5S/c1-5-18(13-16(2)3)22(21(24)25,14-17-7-6-12-23-15-17)29(26,27)20-10-8-19(28-4)9-11-20/h6-13,15,18H,5,14H2,1-4H3,(H,24,25) |
| InChIKey | SWJJGNQVGDXXIF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|