About hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid
hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid (PubChem CID 70151389) has the molecular formula C23H30N2O6S
and a molecular weight of 462.57 g/mol. Its IUPAC name is hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid.
Molecular Properties
| Compound Name | hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid |
| PubChem CID | 70151389 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid |
| SMILES | CCCCCCC#CC(Cc1cccnc1)(C(=O)O)S(=O)(=O)c1ccc(OC)cc1.NO |
| InChI | InChI=1S/C23H27NO5S.H3NO/c1-3-4-5-6-7-8-15-23(22(25)26,17-19-10-9-16-24-18-19)30(27,28)21-13-11-20(29-2)12-14-21;1-2/h9-14,16,18H,3-7,17H2,1-2H3,(H,25,26);2H,1H2 |
| InChIKey | HUCPKLSJVDITKO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid?
The IUPAC name of hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid (CID 70151389) is hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid.
What is the SMILES notation for hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid?
The canonical SMILES for hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid is CCCCCCC#CC(Cc1cccnc1)(C(=O)O)S(=O)(=O)c1ccc(OC)cc1.NO.
What is the InChIKey of hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid?
The InChIKey is HUCPKLSJVDITKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO5S.H3NO/c1-3-4-5-6-7-8-15-23(22(25)26,17-19-10-9-16-24-18-19)30(27,28)21-13-11-20(29-2)12-14-21;1-2/h9-14,16,18H,3-7,17H2,1-2H3,(H,25,26);2H,1H2.
What are the key properties of hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid?
hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid has a molecular weight of 462.57 g/mol, XLogP of 3.24, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;2-(4-methoxyphenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid is sourced from PubChem (CID 70151389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).