C22H26FNO5S — CID 70152356
2-(4-fluorophenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid;hydrate (PubChem CID 70152356) has the molecular formula C22H26FNO5S and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid;hydrate.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid;hydrate |
|---|---|
| PubChem CID | 70152356 |
| Molecular Formula | C22H26FNO5S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-2-(pyridin-3-ylmethyl)dec-3-ynoic acid;hydrate |
| SMILES | CCCCCCC#CC(Cc1cccnc1)(C(=O)O)S(=O)(=O)c1ccc(F)cc1.O |
| InChI | InChI=1S/C22H24FNO4S.H2O/c1-2-3-4-5-6-7-14-22(21(25)26,16-18-9-8-15-24-17-18)29(27,28)20-12-10-19(23)11-13-20;/h8-13,15,17H,2-6,16H2,1H3,(H,25,26);1H2 |
| InChIKey | AGXRZQYJCDVPJQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|