C38H27N3PtS3 — CID 160956175
2,2'-bis(3H-thiophen-3-id-2-yl)spiro[5H-quinoline-6,6'-7,8-dihydro-5H-quinoline];platinum(2+);2-thiophen-2-ylquinoline (PubChem CID 160956175) has the molecular formula C38H27N3PtS3 and a molecular weight of 816.93 g/mol. Its IUPAC name is 2,2'-bis(3H-thiophen-3-id-2-yl)spiro[5H-quinoline-6,6'-7,8-dihydro-5H-quinoline];platinum(2+);2-thiophen-2-ylquinoline.
| Compound Name | 2,2'-bis(3H-thiophen-3-id-2-yl)spiro[5H-quinoline-6,6'-7,8-dihydro-5H-quinoline];platinum(2+);2-thiophen-2-ylquinoline |
|---|---|
| PubChem CID | 160956175 |
| Molecular Formula | C38H27N3PtS3 |
| Molecular Weight | 816.93 g/mol |
| Exact Mass | 816.10 |
| IUPAC Name | 2,2'-bis(3H-thiophen-3-id-2-yl)spiro[5H-quinoline-6,6'-7,8-dihydro-5H-quinoline];platinum(2+);2-thiophen-2-ylquinoline |
| SMILES | [Pt+2].[c-]1ccsc1-c1ccc2c(n1)C=CC1(CCc3nc(-c4[c-]ccs4)ccc3C1)C2.c1csc(-c2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C25H18N2S2.C13H9NS.Pt/c1-3-23(28-13-1)21-7-5-17-15-25(11-9-19(17)26-21)12-10-20-18(16-25)6-8-22(27-20)24-4-2-14-29-24;1-2-5-11-10(4-1)7-8-12(14-11)13-6-3-9-15-13;/h1-2,5-9,11,13-14H,10,12,15-16H2;1-9H;/q-2;;+2 |
| InChIKey | ZHJVICPZILCJBB-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.93 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|