C12H13IrN4O2S2- — CID 153468258
iridium;methanol;3-(3H-thiophen-3-id-2-yl)-6-thiophen-2-yl-1,2,4,5-tetrazine (PubChem CID 153468258) has the molecular formula C12H13IrN4O2S2- and a molecular weight of 501.61 g/mol. Its IUPAC name is iridium;methanol;3-(3H-thiophen-3-id-2-yl)-6-thiophen-2-yl-1,2,4,5-tetrazine.
| Compound Name | iridium;methanol;3-(3H-thiophen-3-id-2-yl)-6-thiophen-2-yl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 153468258 |
| Molecular Formula | C12H13IrN4O2S2- |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | iridium;methanol;3-(3H-thiophen-3-id-2-yl)-6-thiophen-2-yl-1,2,4,5-tetrazine |
| SMILES | CO.CO.[Ir].[c-]1ccsc1-c1nnc(-c2cccs2)nn1 |
| InChI | InChI=1S/C10H5N4S2.2CH4O.Ir/c1-3-7(15-5-1)9-11-13-10(14-12-9)8-4-2-6-16-8;2*1-2;/h1-3,5-6H;2*2H,1H3;/q-1;;; |
| InChIKey | LILWCUOIGDNYBA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|