C16H10N8S3 — CID 177395223
3-thiophen-2-yl-6-[5-(6-thiophen-2-yl-1,4-dihydro-1,2,4,5-tetrazin-3-yl)thiophen-2-yl]-1,2,4,5-tetrazine (PubChem CID 177395223) has the molecular formula C16H10N8S3 and a molecular weight of 410.51 g/mol. Its IUPAC name is 3-thiophen-2-yl-6-[5-(6-thiophen-2-yl-1,4-dihydro-1,2,4,5-tetrazin-3-yl)thiophen-2-yl]-1,2,4,5-tetrazine.
| Compound Name | 3-thiophen-2-yl-6-[5-(6-thiophen-2-yl-1,4-dihydro-1,2,4,5-tetrazin-3-yl)thiophen-2-yl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 177395223 |
| Molecular Formula | C16H10N8S3 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 3-thiophen-2-yl-6-[5-(6-thiophen-2-yl-1,4-dihydro-1,2,4,5-tetrazin-3-yl)thiophen-2-yl]-1,2,4,5-tetrazine |
| SMILES | c1csc(C2=NNC(c3ccc(-c4nnc(-c5cccs5)nn4)s3)=NN2)c1 |
| InChI | InChI=1S/C16H10N8S3/c1-3-9(25-7-1)13-17-21-15(22-18-13)11-5-6-12(27-11)16-23-19-14(20-24-16)10-4-2-8-26-10/h1-8H,(H,17,18)(H,21,22) |
| InChIKey | CXVRGOKDGKYGSX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |