C31H31BClN5O5 — CID 160964051
[3-[2-[[5-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-4-oxopentyl]amino]-2-oxoethyl]phenyl]boronic acid (PubChem CID 160964051) has the molecular formula C31H31BClN5O5 and a molecular weight of 599.88 g/mol. Its IUPAC name is [3-[2-[[5-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-4-oxopentyl]amino]-2-oxoethyl]phenyl]boronic acid.
| Compound Name | [3-[2-[[5-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-4-oxopentyl]amino]-2-oxoethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 160964051 |
| Molecular Formula | C31H31BClN5O5 |
| Molecular Weight | 599.88 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | [3-[2-[[5-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-4-oxopentyl]amino]-2-oxoethyl]phenyl]boronic acid |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)CCCNC(=O)Cc1cccc(B(O)O)c1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C31H31BClN5O5/c1-19-36-37-31-27(17-24(39)7-4-14-34-29(40)16-20-5-3-6-22(15-20)32(41)42)35-30(21-8-10-23(33)11-9-21)26-18-25(43-2)12-13-28(26)38(19)31/h3,5-6,8-13,15,18,27,41-42H,4,7,14,16-17H2,1-2H3,(H,34,40)/t27-/m0/s1 |
| InChIKey | SXJOCHCYLALFMJ-MHZLTWQESA-N |
| XLogP | 2.91 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|