C32H34BClN6O4 — CID 174116418
[3-[5-[[2-[(4S)-6-(4-chlorophenyl)-1,8-dimethyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]pentylcarbamoyl]phenyl]boronic acid (PubChem CID 174116418) has the molecular formula C32H34BClN6O4 and a molecular weight of 612.93 g/mol. Its IUPAC name is [3-[5-[[2-[(4S)-6-(4-chlorophenyl)-1,8-dimethyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]pentylcarbamoyl]phenyl]boronic acid.
| Compound Name | [3-[5-[[2-[(4S)-6-(4-chlorophenyl)-1,8-dimethyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]pentylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 174116418 |
| Molecular Formula | C32H34BClN6O4 |
| Molecular Weight | 612.93 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | [3-[5-[[2-[(4S)-6-(4-chlorophenyl)-1,8-dimethyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]pentylcarbamoyl]phenyl]boronic acid |
| SMILES | Cc1ccc2c(c1)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCCCCNC(=O)c1cccc(B(O)O)c1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C32H34BClN6O4/c1-20-9-14-28-26(17-20)30(22-10-12-25(34)13-11-22)37-27(31-39-38-21(2)40(28)31)19-29(41)35-15-4-3-5-16-36-32(42)23-7-6-8-24(18-23)33(43)44/h6-14,17-18,27,43-44H,3-5,15-16,19H2,1-2H3,(H,35,41)(H,36,42)/t27-/m0/s1 |
| InChIKey | LQEDTFCFNLDQBN-MHZLTWQESA-N |
| XLogP | 3.22 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.93 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|