C26H36ClNO3 — CID 160966303
3-[(4aR)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-8,8-dimethyl-3-oxo-4,5,6,7-tetrahydroisoquinolin-2-yl]propanoic acid (PubChem CID 160966303) has the molecular formula C26H36ClNO3 and a molecular weight of 446.03 g/mol. Its IUPAC name is 3-[(4aR)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-8,8-dimethyl-3-oxo-4,5,6,7-tetrahydroisoquinolin-2-yl]propanoic acid.
| Compound Name | 3-[(4aR)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-8,8-dimethyl-3-oxo-4,5,6,7-tetrahydroisoquinolin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 160966303 |
| Molecular Formula | C26H36ClNO3 |
| Molecular Weight | 446.03 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 3-[(4aR)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-8,8-dimethyl-3-oxo-4,5,6,7-tetrahydroisoquinolin-2-yl]propanoic acid |
| SMILES | CC(C)(C)CCc1ccc([C@]23CCCC(C)(C)C2=CN(CCC(=O)O)C(=O)C3)cc1Cl |
| InChI | InChI=1S/C26H36ClNO3/c1-24(2,3)13-9-18-7-8-19(15-20(18)27)26-12-6-11-25(4,5)21(26)17-28(22(29)16-26)14-10-23(30)31/h7-8,15,17H,6,9-14,16H2,1-5H3,(H,30,31)/t26-/m1/s1 |
| InChIKey | SXRBKQJHPNJHAF-AREMUKBSSA-N |
| XLogP | 6.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.03 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |