C29H38ClNO3 — CID 158289158
3-[(4aS)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-7,7-dimethyl-3-oxo-4,5,6,8-tetrahydroisoquinolin-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid (PubChem CID 158289158) has the molecular formula C29H38ClNO3 and a molecular weight of 484.08 g/mol. Its IUPAC name is 3-[(4aS)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-7,7-dimethyl-3-oxo-4,5,6,8-tetrahydroisoquinolin-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid.
| Compound Name | 3-[(4aS)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-7,7-dimethyl-3-oxo-4,5,6,8-tetrahydroisoquinolin-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
|---|---|
| PubChem CID | 158289158 |
| Molecular Formula | C29H38ClNO3 |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3-[(4aS)-4a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-7,7-dimethyl-3-oxo-4,5,6,8-tetrahydroisoquinolin-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| SMILES | CC(C)(C)CCc1ccc([C@@]23CCC(C)(C)CC2=CN(C24CC(C(=O)O)(C2)C4)C(=O)C3)cc1Cl |
| InChI | InChI=1S/C29H38ClNO3/c1-25(2,3)9-8-19-6-7-20(12-22(19)30)29-11-10-26(4,5)13-21(29)15-31(23(32)14-29)28-16-27(17-28,18-28)24(33)34/h6-7,12,15H,8-11,13-14,16-18H2,1-5H3,(H,33,34)/t27?,28?,29-/m0/s1 |
| InChIKey | GLDKNSCHPKIKQG-PPUMFKDSSA-N |
| XLogP | 6.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |