C29H39ClN2O3 — CID 139548734
3-[(8aR)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-2-oxo-6-propan-2-yl-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]bicyclo[1.1.1]pentane-1-carboxylic acid (PubChem CID 139548734) has the molecular formula C29H39ClN2O3 and a molecular weight of 499.10 g/mol. Its IUPAC name is 3-[(8aR)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-2-oxo-6-propan-2-yl-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]bicyclo[1.1.1]pentane-1-carboxylic acid.
| Compound Name | 3-[(8aR)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-2-oxo-6-propan-2-yl-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
|---|---|
| PubChem CID | 139548734 |
| Molecular Formula | C29H39ClN2O3 |
| Molecular Weight | 499.10 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 3-[(8aR)-8a-[3-chloro-4-(3,3-dimethylbutyl)phenyl]-2-oxo-6-propan-2-yl-5,6,7,8-tetrahydro-1H-quinazolin-3-yl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| SMILES | CC(C)C1CC[C@]2(c3ccc(CCC(C)(C)C)c(Cl)c3)NC(=O)N(C34CC(C(=O)O)(C3)C4)C=C2C1 |
| InChI | InChI=1S/C29H39ClN2O3/c1-18(2)20-9-11-29(21-7-6-19(23(30)13-21)8-10-26(3,4)5)22(12-20)14-32(25(35)31-29)28-15-27(16-28,17-28)24(33)34/h6-7,13-14,18,20H,8-12,15-17H2,1-5H3,(H,31,35)(H,33,34)/t20?,27?,28?,29-/m1/s1 |
| InChIKey | HJQWTSPJCCAUSF-FLMKPNCESA-N |
| XLogP | 6.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.10 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |